C24H35NO6 — CID 23224740
3-[1-(2,5-dimethoxyphenyl)propyl]-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylic acid (PubChem CID 23224740) has the molecular formula C24H35NO6 and a molecular weight of 433.55 g/mol. Its IUPAC name is 3-[1-(2,5-dimethoxyphenyl)propyl]-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylic acid.
| Compound Name | 3-[1-(2,5-dimethoxyphenyl)propyl]-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 23224740 |
| Molecular Formula | C24H35NO6 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 3-[1-(2,5-dimethoxyphenyl)propyl]-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylic acid |
| SMILES | CCC(c1cc(OC)ccc1OC)C1CCCN(C(=O)C(=O)C(C)(C)CC)C1C(=O)O |
| InChI | InChI=1S/C24H35NO6/c1-7-16(18-14-15(30-5)11-12-19(18)31-6)17-10-9-13-25(20(17)23(28)29)22(27)21(26)24(3,4)8-2/h11-12,14,16-17,20H,7-10,13H2,1-6H3,(H,28,29) |
| InChIKey | HJQNPGFARVOFTR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|