C21H27N3O5 — CID 15981161
1-[2-(5,6-dimethoxybenzimidazole-1-carbonyl)pyrrolidin-1-yl]-3,3-dimethylpentane-1,2-dione (PubChem CID 15981161) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is 1-[2-(5,6-dimethoxybenzimidazole-1-carbonyl)pyrrolidin-1-yl]-3,3-dimethylpentane-1,2-dione.
| Compound Name | 1-[2-(5,6-dimethoxybenzimidazole-1-carbonyl)pyrrolidin-1-yl]-3,3-dimethylpentane-1,2-dione |
|---|---|
| PubChem CID | 15981161 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 1-[2-(5,6-dimethoxybenzimidazole-1-carbonyl)pyrrolidin-1-yl]-3,3-dimethylpentane-1,2-dione |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCC1C(=O)n1cnc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C21H27N3O5/c1-6-21(2,3)18(25)20(27)23-9-7-8-14(23)19(26)24-12-22-13-10-16(28-4)17(29-5)11-15(13)24/h10-12,14H,6-9H2,1-5H3 |
| InChIKey | RCGHQDXOFBVCIP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|