C25H37N3O7 — CID 23532246
1-(3,3-dimethyl-2-oxopentanoyl)-N'-[3-(3,4,5-trimethoxyphenyl)propanoyl]piperidine-2-carbohydrazide (PubChem CID 23532246) has the molecular formula C25H37N3O7 and a molecular weight of 491.59 g/mol. Its IUPAC name is 1-(3,3-dimethyl-2-oxopentanoyl)-N'-[3-(3,4,5-trimethoxyphenyl)propanoyl]piperidine-2-carbohydrazide.
| Compound Name | 1-(3,3-dimethyl-2-oxopentanoyl)-N'-[3-(3,4,5-trimethoxyphenyl)propanoyl]piperidine-2-carbohydrazide |
|---|---|
| PubChem CID | 23532246 |
| Molecular Formula | C25H37N3O7 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | 1-(3,3-dimethyl-2-oxopentanoyl)-N'-[3-(3,4,5-trimethoxyphenyl)propanoyl]piperidine-2-carbohydrazide |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCCC1C(=O)NNC(=O)CCc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C25H37N3O7/c1-7-25(2,3)22(30)24(32)28-13-9-8-10-17(28)23(31)27-26-20(29)12-11-16-14-18(33-4)21(35-6)19(15-16)34-5/h14-15,17H,7-13H2,1-6H3,(H,26,29)(H,27,31) |
| InChIKey | YJVXMHYJJMEZRC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|