C15H20N2O4 — CID 26798763
N'-[3-(3,4-dimethoxyphenyl)propanoyl]cyclopropanecarbohydrazide (PubChem CID 26798763) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is N'-[3-(3,4-dimethoxyphenyl)propanoyl]cyclopropanecarbohydrazide.
| Compound Name | N'-[3-(3,4-dimethoxyphenyl)propanoyl]cyclopropanecarbohydrazide |
|---|---|
| PubChem CID | 26798763 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | N'-[3-(3,4-dimethoxyphenyl)propanoyl]cyclopropanecarbohydrazide |
| SMILES | COc1ccc(CCC(=O)NNC(=O)C2CC2)cc1OC |
| InChI | InChI=1S/C15H20N2O4/c1-20-12-7-3-10(9-13(12)21-2)4-8-14(18)16-17-15(19)11-5-6-11/h3,7,9,11H,4-6,8H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | ZEQFUMMZGDJKJP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|