C12H19N3O — CID 23227060
N,2-dimethyl-5-(pyrrolidin-2-ylmethoxy)pyridin-3-amine (PubChem CID 23227060) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is N,2-dimethyl-5-(pyrrolidin-2-ylmethoxy)pyridin-3-amine.
| Compound Name | N,2-dimethyl-5-(pyrrolidin-2-ylmethoxy)pyridin-3-amine |
|---|---|
| PubChem CID | 23227060 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | N,2-dimethyl-5-(pyrrolidin-2-ylmethoxy)pyridin-3-amine |
| SMILES | CNc1cc(OCC2CCCN2)cnc1C |
| InChI | InChI=1S/C12H19N3O/c1-9-12(13-2)6-11(7-15-9)16-8-10-4-3-5-14-10/h6-7,10,13-14H,3-5,8H2,1-2H3 |
| InChIKey | ZULLNQCPQZRAOB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |