C12H16FN3O2 — CID 54387208
N-[2-fluoro-5-[[(2R)-pyrrolidin-2-yl]methoxy]-3-pyridinyl]acetamide (PubChem CID 54387208) has the molecular formula C12H16FN3O2 and a molecular weight of 253.28 g/mol. Its IUPAC name is N-[2-fluoro-5-[[(2R)-pyrrolidin-2-yl]methoxy]-3-pyridinyl]acetamide.
| Compound Name | N-[2-fluoro-5-[[(2R)-pyrrolidin-2-yl]methoxy]-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 54387208 |
| Molecular Formula | C12H16FN3O2 |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | N-[2-fluoro-5-[[(2R)-pyrrolidin-2-yl]methoxy]-3-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1cc(OC[C@H]2CCCN2)cnc1F |
| InChI | InChI=1S/C12H16FN3O2/c1-8(17)16-11-5-10(6-15-12(11)13)18-7-9-3-2-4-14-9/h5-6,9,14H,2-4,7H2,1H3,(H,16,17)/t9-/m1/s1 |
| InChIKey | VEBSKENDUAXNMF-SECBINFHSA-N |
| XLogP | 1.31 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|