C17H25ClN4O3 — CID 54158525
N-[2-chloro-5,6-bis[[(2R)-pyrrolidin-2-yl]methoxy]-3-pyridinyl]acetamide (PubChem CID 54158525) has the molecular formula C17H25ClN4O3 and a molecular weight of 368.87 g/mol. Its IUPAC name is N-[2-chloro-5,6-bis[[(2R)-pyrrolidin-2-yl]methoxy]-3-pyridinyl]acetamide.
| Compound Name | N-[2-chloro-5,6-bis[[(2R)-pyrrolidin-2-yl]methoxy]-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 54158525 |
| Molecular Formula | C17H25ClN4O3 |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-[2-chloro-5,6-bis[[(2R)-pyrrolidin-2-yl]methoxy]-3-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1cc(OC[C@H]2CCCN2)c(OC[C@H]2CCCN2)nc1Cl |
| InChI | InChI=1S/C17H25ClN4O3/c1-11(23)21-14-8-15(24-9-12-4-2-6-19-12)17(22-16(14)18)25-10-13-5-3-7-20-13/h8,12-13,19-20H,2-7,9-10H2,1H3,(H,21,23)/t12-,13-/m1/s1 |
| InChIKey | OMTXILWFAOICCB-CHWSQXEVSA-N |
| XLogP | 1.96 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|