C11H16Cl3N3O2 — CID 66962076
5-chloro-3-[[(2R)-pyrrolidin-2-yl]methoxy]pyridine-2-carboxamide;dihydrochloride (PubChem CID 66962076) has the molecular formula C11H16Cl3N3O2 and a molecular weight of 328.63 g/mol. Its IUPAC name is 5-chloro-3-[[(2R)-pyrrolidin-2-yl]methoxy]pyridine-2-carboxamide;dihydrochloride.
| Compound Name | 5-chloro-3-[[(2R)-pyrrolidin-2-yl]methoxy]pyridine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 66962076 |
| Molecular Formula | C11H16Cl3N3O2 |
| Molecular Weight | 328.63 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 5-chloro-3-[[(2R)-pyrrolidin-2-yl]methoxy]pyridine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)c1ncc(Cl)cc1OC[C@H]1CCCN1 |
| InChI | InChI=1S/C11H14ClN3O2.2ClH/c12-7-4-9(10(11(13)16)15-5-7)17-6-8-2-1-3-14-8;;/h4-5,8,14H,1-3,6H2,(H2,13,16);2*1H/t8-;;/m1../s1 |
| InChIKey | WHETWHOGHHMWJU-YCBDHFTFSA-N |
| XLogP | 1.81 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.63 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |