C10H10ClN3O2S — CID 23228255
3-[(4-chlorophenyl)sulfonylmethyl]-5-methyl-1H-1,2,4-triazole (PubChem CID 23228255) has the molecular formula C10H10ClN3O2S and a molecular weight of 271.73 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)sulfonylmethyl]-5-methyl-1H-1,2,4-triazole.
| Compound Name | 3-[(4-chlorophenyl)sulfonylmethyl]-5-methyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 23228255 |
| Molecular Formula | C10H10ClN3O2S |
| Molecular Weight | 271.73 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 3-[(4-chlorophenyl)sulfonylmethyl]-5-methyl-1H-1,2,4-triazole |
| SMILES | Cc1nc(CS(=O)(=O)c2ccc(Cl)cc2)n[nH]1 |
| InChI | InChI=1S/C10H10ClN3O2S/c1-7-12-10(14-13-7)6-17(15,16)9-4-2-8(11)3-5-9/h2-5H,6H2,1H3,(H,12,13,14) |
| InChIKey | WUUWNGREUBCHJQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.73 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |