C9H8ClN3S2 — CID 66561921
3-[(4-chlorophenyl)disulfanyl]-5-methyl-1H-1,2,4-triazole (PubChem CID 66561921) has the molecular formula C9H8ClN3S2 and a molecular weight of 257.77 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)disulfanyl]-5-methyl-1H-1,2,4-triazole.
| Compound Name | 3-[(4-chlorophenyl)disulfanyl]-5-methyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 66561921 |
| Molecular Formula | C9H8ClN3S2 |
| Molecular Weight | 257.77 g/mol |
| Exact Mass | 256.98 |
| IUPAC Name | 3-[(4-chlorophenyl)disulfanyl]-5-methyl-1H-1,2,4-triazole |
| SMILES | Cc1nc(SSc2ccc(Cl)cc2)n[nH]1 |
| InChI | InChI=1S/C9H8ClN3S2/c1-6-11-9(13-12-6)15-14-8-4-2-7(10)3-5-8/h2-5H,1H3,(H,11,12,13) |
| InChIKey | ZIWJLGYMMGZNMF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.77 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|