C14H28Cl2NTi- — CID 23229327
cyclopentane;dichlorotitanium;2,2,4,4-tetramethylpentan-3-ylideneazanide (PubChem CID 23229327) has the molecular formula C14H28Cl2NTi- and a molecular weight of 329.16 g/mol. Its IUPAC name is cyclopentane;dichlorotitanium;2,2,4,4-tetramethylpentan-3-ylideneazanide.
| Compound Name | cyclopentane;dichlorotitanium;2,2,4,4-tetramethylpentan-3-ylideneazanide |
|---|---|
| PubChem CID | 23229327 |
| Molecular Formula | C14H28Cl2NTi- |
| Molecular Weight | 329.16 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | cyclopentane;dichlorotitanium;2,2,4,4-tetramethylpentan-3-ylideneazanide |
| SMILES | C1CCCC1.CC(C)(C)C(=[N-])C(C)(C)C.Cl[Ti]Cl |
| InChI | InChI=1S/C9H18N.C5H10.2ClH.Ti/c1-8(2,3)7(10)9(4,5)6;1-2-4-5-3-1;;;/h1-6H3;1-5H2;2*1H;/q-1;;;;+2/p-2 |
| InChIKey | TYAUSQPBGWSJFE-UHFFFAOYSA-L |
| XLogP | 6.42 |
| TPSA | 22.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.16 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|