C10H21Cl2NTi-2 — CID 153465289
carbanide;dichlorotitanium;2,2,4,4-tetramethylpentan-3-ylideneazanide (PubChem CID 153465289) has the molecular formula C10H21Cl2NTi-2 and a molecular weight of 274.06 g/mol. Its IUPAC name is carbanide;dichlorotitanium;2,2,4,4-tetramethylpentan-3-ylideneazanide.
| Compound Name | carbanide;dichlorotitanium;2,2,4,4-tetramethylpentan-3-ylideneazanide |
|---|---|
| PubChem CID | 153465289 |
| Molecular Formula | C10H21Cl2NTi-2 |
| Molecular Weight | 274.06 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | carbanide;dichlorotitanium;2,2,4,4-tetramethylpentan-3-ylideneazanide |
| SMILES | CC(C)(C)C(=[N-])C(C)(C)C.Cl[Ti]Cl.[CH3-] |
| InChI | InChI=1S/C9H18N.CH3.2ClH.Ti/c1-8(2,3)7(10)9(4,5)6;;;;/h1-6H3;1H3;2*1H;/q2*-1;;;+2/p-2 |
| InChIKey | XMDOQQYHKUNDBU-UHFFFAOYSA-L |
| XLogP | 4.92 |
| TPSA | 22.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.06 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|