C9H18LiN — CID 101048200
lithium 2,2,4,4-tetramethylpentan-3-ylideneazanide (PubChem CID 101048200) has the molecular formula C9H18LiN and a molecular weight of 147.19 g/mol. Its IUPAC name is lithium 2,2,4,4-tetramethylpentan-3-ylideneazanide.
| Compound Name | lithium 2,2,4,4-tetramethylpentan-3-ylideneazanide |
|---|---|
| PubChem CID | 101048200 |
| Molecular Formula | C9H18LiN |
| Molecular Weight | 147.19 g/mol |
| Exact Mass | 147.16 |
| IUPAC Name | lithium 2,2,4,4-tetramethylpentan-3-ylideneazanide |
| SMILES | CC(C)(C)C(=[N-])C(C)(C)C.[Li+] |
| InChI | InChI=1S/C9H18N.Li/c1-8(2,3)7(10)9(4,5)6;/h1-6H3;/q-1;+1 |
| InChIKey | OKBBWWUVUMKOMH-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 22.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.19 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|