C14H28N2 — CID 134897223
(E)-N-[(Z)-4,4-dimethylpentan-2-ylideneamino]-4,4-dimethylpentan-2-imine (PubChem CID 134897223) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is (E)-N-[(Z)-4,4-dimethylpentan-2-ylideneamino]-4,4-dimethylpentan-2-imine.
| Compound Name | (E)-N-[(Z)-4,4-dimethylpentan-2-ylideneamino]-4,4-dimethylpentan-2-imine |
|---|---|
| PubChem CID | 134897223 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | (E)-N-[(Z)-4,4-dimethylpentan-2-ylideneamino]-4,4-dimethylpentan-2-imine |
| SMILES | C/C(CC(C)(C)C)=N/N=C(\C)CC(C)(C)C |
| InChI | InChI=1S/C14H28N2/c1-11(9-13(3,4)5)15-16-12(2)10-14(6,7)8/h9-10H2,1-8H3/b15-11-,16-12+ |
| InChIKey | QLVULGZEFBZVOJ-UKVBVZPVSA-N |
| XLogP | 4.70 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|