C16H32N2 — CID 134883173
(E)-N-[(Z)-5,5-dimethylhexan-3-ylideneamino]-5,5-dimethylhexan-3-imine (PubChem CID 134883173) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is (E)-N-[(Z)-5,5-dimethylhexan-3-ylideneamino]-5,5-dimethylhexan-3-imine.
| Compound Name | (E)-N-[(Z)-5,5-dimethylhexan-3-ylideneamino]-5,5-dimethylhexan-3-imine |
|---|---|
| PubChem CID | 134883173 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | (E)-N-[(Z)-5,5-dimethylhexan-3-ylideneamino]-5,5-dimethylhexan-3-imine |
| SMILES | CC/C(CC(C)(C)C)=N/N=C(\CC)CC(C)(C)C |
| InChI | InChI=1S/C16H32N2/c1-9-13(11-15(3,4)5)17-18-14(10-2)12-16(6,7)8/h9-12H2,1-8H3/b17-13-,18-14+ |
| InChIKey | PYLLTSWJRDLJMA-SIJTWYJSSA-N |
| XLogP | 5.48 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|