C18H36N2 — CID 638163
2,2,4,4-tetramethyl-N-(2,2,4,4-tetramethylpentan-3-ylideneamino)pentan-3-imine (PubChem CID 638163) has the molecular formula C18H36N2 and a molecular weight of 280.50 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-N-(2,2,4,4-tetramethylpentan-3-ylideneamino)pentan-3-imine.
| Compound Name | 2,2,4,4-tetramethyl-N-(2,2,4,4-tetramethylpentan-3-ylideneamino)pentan-3-imine |
|---|---|
| PubChem CID | 638163 |
| Molecular Formula | C18H36N2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.29 |
| IUPAC Name | 2,2,4,4-tetramethyl-N-(2,2,4,4-tetramethylpentan-3-ylideneamino)pentan-3-imine |
| SMILES | CC(C)(C)C(=NN=C(C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H36N2/c1-15(2,3)13(16(4,5)6)19-20-14(17(7,8)9)18(10,11)12/h1-12H3 |
| InChIKey | DWMHYMBCBXWYLA-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|