C12H24N2 — CID 134897185
(E)-N-[(Z)-3,3-dimethylbutan-2-ylideneamino]-3,3-dimethylbutan-2-imine (PubChem CID 134897185) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is (E)-N-[(Z)-3,3-dimethylbutan-2-ylideneamino]-3,3-dimethylbutan-2-imine.
| Compound Name | (E)-N-[(Z)-3,3-dimethylbutan-2-ylideneamino]-3,3-dimethylbutan-2-imine |
|---|---|
| PubChem CID | 134897185 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | (E)-N-[(Z)-3,3-dimethylbutan-2-ylideneamino]-3,3-dimethylbutan-2-imine |
| SMILES | C/C(=N/N=C(\C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H24N2/c1-9(11(3,4)5)13-14-10(2)12(6,7)8/h1-8H3/b13-9-,14-10+ |
| InChIKey | MYKADEMIRVFALV-ZKLMZBBOSA-N |
| XLogP | 3.92 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|