C9H20N+ — CID 7019373
2,2,4,4-tetramethylpentan-3-ylideneazanium (PubChem CID 7019373) has the molecular formula C9H20N+ and a molecular weight of 142.27 g/mol. Its IUPAC name is 2,2,4,4-tetramethylpentan-3-ylideneazanium.
| Compound Name | 2,2,4,4-tetramethylpentan-3-ylideneazanium |
|---|---|
| PubChem CID | 7019373 |
| Molecular Formula | C9H20N+ |
| Molecular Weight | 142.27 g/mol |
| Exact Mass | 142.16 |
| IUPAC Name | 2,2,4,4-tetramethylpentan-3-ylideneazanium |
| SMILES | CC(C)(C)C(=[NH2+])C(C)(C)C |
| InChI | InChI=1S/C9H19N/c1-8(2,3)7(10)9(4,5)6/h10H,1-6H3/p+1 |
| InChIKey | VCMKYJMEMATQPE-UHFFFAOYSA-O |
| XLogP | 1.28 |
| TPSA | 25.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|