C14H29NY-2 — CID 58488616
2-methylpropane;2,2,5,5-tetramethylhexan-3-ylideneazanide;yttrium (PubChem CID 58488616) has the molecular formula C14H29NY-2 and a molecular weight of 300.30 g/mol. Its IUPAC name is 2-methylpropane;2,2,5,5-tetramethylhexan-3-ylideneazanide;yttrium.
| Compound Name | 2-methylpropane;2,2,5,5-tetramethylhexan-3-ylideneazanide;yttrium |
|---|---|
| PubChem CID | 58488616 |
| Molecular Formula | C14H29NY-2 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-methylpropane;2,2,5,5-tetramethylhexan-3-ylideneazanide;yttrium |
| SMILES | CC(C)(C)CC(=[N-])C(C)(C)C.C[C-](C)C.[Y] |
| InChI | InChI=1S/C10H20N.C4H9.Y/c1-9(2,3)7-8(11)10(4,5)6;1-4(2)3;/h7H2,1-6H3;1-3H3;/q2*-1; |
| InChIKey | AYHSCOZZFMGFTN-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 22.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|