C10H18N2WY-2 — CID 58853498
(4-azanidylidene-2,2,5,5-tetramethylhexan-3-ylidene)azanide;tungsten;yttrium (PubChem CID 58853498) has the molecular formula C10H18N2WY-2 and a molecular weight of 439.01 g/mol. Its IUPAC name is (4-azanidylidene-2,2,5,5-tetramethylhexan-3-ylidene)azanide;tungsten;yttrium.
| Compound Name | (4-azanidylidene-2,2,5,5-tetramethylhexan-3-ylidene)azanide;tungsten;yttrium |
|---|---|
| PubChem CID | 58853498 |
| Molecular Formula | C10H18N2WY-2 |
| Molecular Weight | 439.01 g/mol |
| Exact Mass | 439.00 |
| IUPAC Name | (4-azanidylidene-2,2,5,5-tetramethylhexan-3-ylidene)azanide;tungsten;yttrium |
| SMILES | CC(C)(C)C(=[N-])C(=[N-])C(C)(C)C.[W].[Y] |
| InChI | InChI=1S/C10H18N2.W.Y/c1-9(2,3)7(11)8(12)10(4,5)6;;/h1-6H3;;/q-2;; |
| InChIKey | FLSAARBRSAHZDQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 44.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.01 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|