C23H25N3O2 — CID 23231975
(1S,2S,3S,4S)-3-N-(2,6-dimethylphenyl)-2-N-(pyridin-2-ylmethyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide (PubChem CID 23231975) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is (1S,2S,3S,4S)-3-N-(2,6-dimethylphenyl)-2-N-(pyridin-2-ylmethyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide.
| Compound Name | (1S,2S,3S,4S)-3-N-(2,6-dimethylphenyl)-2-N-(pyridin-2-ylmethyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
|---|---|
| PubChem CID | 23231975 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | (1S,2S,3S,4S)-3-N-(2,6-dimethylphenyl)-2-N-(pyridin-2-ylmethyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)[C@@H]1[C@@H](C(=O)NCc2ccccn2)[C@@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C23H25N3O2/c1-14-6-5-7-15(2)21(14)26-23(28)20-17-10-9-16(12-17)19(20)22(27)25-13-18-8-3-4-11-24-18/h3-11,16-17,19-20H,12-13H2,1-2H3,(H,25,27)(H,26,28)/t16-,17-,19+,20+/m1/s1 |
| InChIKey | YKZLNUQIVRBFHZ-JYBIWHBTSA-N |
| XLogP | 3.39 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|