C23H25N3O4 — CID 98086819
(1R,2S,3S,4R)-3-N-(2,5-dimethoxyphenyl)-2-N-(pyridin-2-ylmethyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide (PubChem CID 98086819) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is (1R,2S,3S,4R)-3-N-(2,5-dimethoxyphenyl)-2-N-(pyridin-2-ylmethyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide.
| Compound Name | (1R,2S,3S,4R)-3-N-(2,5-dimethoxyphenyl)-2-N-(pyridin-2-ylmethyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
|---|---|
| PubChem CID | 98086819 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | (1R,2S,3S,4R)-3-N-(2,5-dimethoxyphenyl)-2-N-(pyridin-2-ylmethyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)[C@@H]2[C@@H](C(=O)NCc3ccccn3)[C@H]3C=C[C@H]2C3)c1 |
| InChI | InChI=1S/C23H25N3O4/c1-29-17-8-9-19(30-2)18(12-17)26-23(28)21-15-7-6-14(11-15)20(21)22(27)25-13-16-5-3-4-10-24-16/h3-10,12,14-15,20-21H,11,13H2,1-2H3,(H,25,27)(H,26,28)/t14-,15-,20-,21-/m0/s1 |
| InChIKey | OFIVDMDFRYKPSW-PBFVBANWSA-N |
| XLogP | 2.79 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|