C12H18O4RuS2 — CID 23232184
cyclohexane;(Z)-1,4-dimethoxy-1,4-dioxobut-2-ene-2,3-dithiolate;ruthenium(2+) (PubChem CID 23232184) has the molecular formula C12H18O4RuS2 and a molecular weight of 391.48 g/mol. Its IUPAC name is cyclohexane;(Z)-1,4-dimethoxy-1,4-dioxobut-2-ene-2,3-dithiolate;ruthenium(2+).
| Compound Name | cyclohexane;(Z)-1,4-dimethoxy-1,4-dioxobut-2-ene-2,3-dithiolate;ruthenium(2+) |
|---|---|
| PubChem CID | 23232184 |
| Molecular Formula | C12H18O4RuS2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.97 |
| IUPAC Name | cyclohexane;(Z)-1,4-dimethoxy-1,4-dioxobut-2-ene-2,3-dithiolate;ruthenium(2+) |
| SMILES | C1CCCCC1.COC(=O)/C([S-])=C(/[S-])C(=O)OC.[Ru+2] |
| InChI | InChI=1S/C6H8O4S2.C6H12.Ru/c1-9-5(7)3(11)4(12)6(8)10-2;1-2-4-6-5-3-1;/h11-12H,1-2H3;1-6H2;/q;;+2/p-2/b4-3-;; |
| InChIKey | HYTXNLNWCMMGKG-GSBNXNDCSA-L |
| XLogP | 1.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|