About carbon monoxide;iron(2+);(9R)-9-(oxomethoxy)-1-phenylmethoxydecan-5-one
carbon monoxide;iron(2+);(9R)-9-(oxomethoxy)-1-phenylmethoxydecan-5-one (PubChem CID 23232555) has the molecular formula C21H25FeO7+
and a molecular weight of 445.27 g/mol. Its IUPAC name is carbon monoxide;iron(2+);(9R)-9-(oxomethoxy)-1-phenylmethoxydecan-5-one.
Molecular Properties
| Compound Name | carbon monoxide;iron(2+);(9R)-9-(oxomethoxy)-1-phenylmethoxydecan-5-one |
| PubChem CID | 23232555 |
| Molecular Formula | C21H25FeO7+ |
| Molecular Weight | 445.27 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | carbon monoxide;iron(2+);(9R)-9-(oxomethoxy)-1-phenylmethoxydecan-5-one |
| SMILES | C[C@H](CCCC(=O)CCCCOCc1ccccc1)O[C-]=O.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe+2] |
| InChI | InChI=1S/C18H25O4.3CO.Fe/c1-16(22-15-19)8-7-12-18(20)11-5-6-13-21-14-17-9-3-2-4-10-17;3*1-2;/h2-4,9-10,16H,5-8,11-14H2,1H3;;;;/q-1;;;;+2/t16-;;;;/m1..../s1 |
| InChIKey | ZDIQAUJXMBFTCQ-XIYRCBLHSA-N |
| XLogP | 3.47 |
| TPSA | 112.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;iron(2+);(9R)-9-(oxomethoxy)-1-phenylmethoxydecan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;iron(2+);(9R)-9-(oxomethoxy)-1-phenylmethoxydecan-5-one?
The IUPAC name of carbon monoxide;iron(2+);(9R)-9-(oxomethoxy)-1-phenylmethoxydecan-5-one (CID 23232555) is carbon monoxide;iron(2+);(9R)-9-(oxomethoxy)-1-phenylmethoxydecan-5-one.
What is the SMILES notation for carbon monoxide;iron(2+);(9R)-9-(oxomethoxy)-1-phenylmethoxydecan-5-one?
The canonical SMILES for carbon monoxide;iron(2+);(9R)-9-(oxomethoxy)-1-phenylmethoxydecan-5-one is C[C@H](CCCC(=O)CCCCOCc1ccccc1)O[C-]=O.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe+2].
What is the InChIKey of carbon monoxide;iron(2+);(9R)-9-(oxomethoxy)-1-phenylmethoxydecan-5-one?
The InChIKey is ZDIQAUJXMBFTCQ-XIYRCBLHSA-N. The full InChI is InChI=1S/C18H25O4.3CO.Fe/c1-16(22-15-19)8-7-12-18(20)11-5-6-13-21-14-17-9-3-2-4-10-17;3*1-2;/h2-4,9-10,16H,5-8,11-14H2,1H3;;;;/q-1;;;;+2/t16-;;;;/m1..../s1.
What are the key properties of carbon monoxide;iron(2+);(9R)-9-(oxomethoxy)-1-phenylmethoxydecan-5-one?
carbon monoxide;iron(2+);(9R)-9-(oxomethoxy)-1-phenylmethoxydecan-5-one has a molecular weight of 445.27 g/mol, XLogP of 3.47, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;iron(2+);(9R)-9-(oxomethoxy)-1-phenylmethoxydecan-5-one is sourced from PubChem (CID 23232555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).