About CID 11419351
CID 11419351 (PubChem CID 11419351) has the molecular formula C21H22FeO7+
and a molecular weight of 442.25 g/mol.
Molecular Properties
| Compound Name | CID 11419351 |
| PubChem CID | 11419351 |
| Molecular Formula | C21H22FeO7+ |
| Molecular Weight | 442.25 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | — |
| SMILES | C[C@H]([CH][CH][CH]C(=O)CCCCOCc1ccccc1)O[C-]=O.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe+2] |
| InChI | InChI=1S/C18H22O4.3CO.Fe/c1-16(22-15-19)8-7-12-18(20)11-5-6-13-21-14-17-9-3-2-4-10-17;3*1-2;/h2-4,7-10,12,16H,5-6,11,13-14H2,1H3;;;;/q-1;;;;+2/t16-;;;;/m1..../s1 |
| InChIKey | INMREBUATDACMG-XIYRCBLHSA-N |
| XLogP | 2.91 |
| TPSA | 112.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 11419351 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11419351?
The IUPAC name of CID 11419351 (CID 11419351) is not available.
What is the SMILES notation for CID 11419351?
The canonical SMILES for CID 11419351 is C[C@H]([CH][CH][CH]C(=O)CCCCOCc1ccccc1)O[C-]=O.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe+2].
What is the InChIKey of CID 11419351?
The InChIKey is INMREBUATDACMG-XIYRCBLHSA-N. The full InChI is InChI=1S/C18H22O4.3CO.Fe/c1-16(22-15-19)8-7-12-18(20)11-5-6-13-21-14-17-9-3-2-4-10-17;3*1-2;/h2-4,7-10,12,16H,5-6,11,13-14H2,1H3;;;;/q-1;;;;+2/t16-;;;;/m1..../s1.
What are the key properties of CID 11419351?
CID 11419351 has a molecular weight of 442.25 g/mol, XLogP of 2.91, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11419351 is sourced from PubChem (CID 11419351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).