C6Cl2F8 — CID 23233385
3-chloro-1-[chloro(difluoro)methyl]-3,4,4-trifluoro-2-(trifluoromethyl)cyclobutene (PubChem CID 23233385) has the molecular formula C6Cl2F8 and a molecular weight of 294.96 g/mol. Its IUPAC name is 3-chloro-1-[chloro(difluoro)methyl]-3,4,4-trifluoro-2-(trifluoromethyl)cyclobutene.
| Compound Name | 3-chloro-1-[chloro(difluoro)methyl]-3,4,4-trifluoro-2-(trifluoromethyl)cyclobutene |
|---|---|
| PubChem CID | 23233385 |
| Molecular Formula | C6Cl2F8 |
| Molecular Weight | 294.96 g/mol |
| Exact Mass | 293.92 |
| IUPAC Name | 3-chloro-1-[chloro(difluoro)methyl]-3,4,4-trifluoro-2-(trifluoromethyl)cyclobutene |
| SMILES | FC(F)(F)C1=C(C(F)(F)Cl)C(F)(F)C1(F)Cl |
| InChI | InChI=1S/C6Cl2F8/c7-3(9)1(6(14,15)16)2(4(3,10)11)5(8,12)13 |
| InChIKey | UBAAFZVTXHNDDM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.96 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|