C7H6F6S — CID 23233535
6,6-bis(trifluoromethyl)-2,5-dihydrothiopyran (PubChem CID 23233535) has the molecular formula C7H6F6S and a molecular weight of 236.18 g/mol. Its IUPAC name is 6,6-bis(trifluoromethyl)-2,5-dihydrothiopyran.
| Compound Name | 6,6-bis(trifluoromethyl)-2,5-dihydrothiopyran |
|---|---|
| PubChem CID | 23233535 |
| Molecular Formula | C7H6F6S |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | 6,6-bis(trifluoromethyl)-2,5-dihydrothiopyran |
| SMILES | FC(F)(F)C1(C(F)(F)F)CC=CCS1 |
| InChI | InChI=1S/C7H6F6S/c8-6(9,10)5(7(11,12)13)3-1-2-4-14-5/h1-2H,3-4H2 |
| InChIKey | OBYVTTICRORKQY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|