C8H8F2 — CID 23234185
1,3-bis(fluoromethyl)benzene (PubChem CID 23234185) has the molecular formula C8H8F2 and a molecular weight of 142.15 g/mol. Its IUPAC name is 1,3-bis(fluoromethyl)benzene.
| Compound Name | 1,3-bis(fluoromethyl)benzene |
|---|---|
| PubChem CID | 23234185 |
| Molecular Formula | C8H8F2 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 1,3-bis(fluoromethyl)benzene |
| SMILES | FCc1cccc(CF)c1 |
| InChI | InChI=1S/C8H8F2/c9-5-7-2-1-3-8(4-7)6-10/h1-4H,5-6H2 |
| InChIKey | CSWGHVOWBGYQII-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |