C12H16FN3O2 — CID 118494424
N-[[3-(fluoromethyl)phenyl]methyl]-4-hydrazinyl-4-oxobutanamide (PubChem CID 118494424) has the molecular formula C12H16FN3O2 and a molecular weight of 253.28 g/mol. Its IUPAC name is N-[[3-(fluoromethyl)phenyl]methyl]-4-hydrazinyl-4-oxobutanamide.
| Compound Name | N-[[3-(fluoromethyl)phenyl]methyl]-4-hydrazinyl-4-oxobutanamide |
|---|---|
| PubChem CID | 118494424 |
| Molecular Formula | C12H16FN3O2 |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | N-[[3-(fluoromethyl)phenyl]methyl]-4-hydrazinyl-4-oxobutanamide |
| SMILES | NNC(=O)CCC(=O)NCc1cccc(CF)c1 |
| InChI | InChI=1S/C12H16FN3O2/c13-7-9-2-1-3-10(6-9)8-15-11(17)4-5-12(18)16-14/h1-3,6H,4-5,7-8,14H2,(H,15,17)(H,16,18) |
| InChIKey | HGRPQXIXOMJILK-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|