C14H25FO4Si — CID 23234396
(3aR,5S,6S,6aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-fluoro-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 23234396) has the molecular formula C14H25FO4Si and a molecular weight of 304.43 g/mol. Its IUPAC name is (3aR,5S,6S,6aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-fluoro-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,5S,6S,6aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-fluoro-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 23234396 |
| Molecular Formula | C14H25FO4Si |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (3aR,5S,6S,6aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-fluoro-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC1[C@H]2CC(=O)O[C@H]2[C@@H](F)[C@H]1O |
| InChI | InChI=1S/C14H25FO4Si/c1-14(2,3)20(4,5)18-7-9-8-6-10(16)19-13(8)11(15)12(9)17/h8-9,11-13,17H,6-7H2,1-5H3/t8-,9?,11+,12+,13-/m1/s1 |
| InChIKey | DZEKYLPTJLOPIO-GHQLJDSLSA-N |
| XLogP | 2.27 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|