C10H16F4O3 — CID 23234668
propyl 3,4,4,4-tetrafluoro-2-propoxybutanoate (PubChem CID 23234668) has the molecular formula C10H16F4O3 and a molecular weight of 260.23 g/mol. Its IUPAC name is propyl 3,4,4,4-tetrafluoro-2-propoxybutanoate.
| Compound Name | propyl 3,4,4,4-tetrafluoro-2-propoxybutanoate |
|---|---|
| PubChem CID | 23234668 |
| Molecular Formula | C10H16F4O3 |
| Molecular Weight | 260.23 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | propyl 3,4,4,4-tetrafluoro-2-propoxybutanoate |
| SMILES | CCCOC(=O)C(OCCC)C(F)C(F)(F)F |
| InChI | InChI=1S/C10H16F4O3/c1-3-5-16-7(8(11)10(12,13)14)9(15)17-6-4-2/h7-8H,3-6H2,1-2H3 |
| InChIKey | JOMKLYIJVQBRQB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |