C9H11F5O — CID 23236511
1,1,3,3,3-pentafluoroprop-1-en-2-yloxycyclohexane (PubChem CID 23236511) has the molecular formula C9H11F5O and a molecular weight of 230.18 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoroprop-1-en-2-yloxycyclohexane.
| Compound Name | 1,1,3,3,3-pentafluoroprop-1-en-2-yloxycyclohexane |
|---|---|
| PubChem CID | 23236511 |
| Molecular Formula | C9H11F5O |
| Molecular Weight | 230.18 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 1,1,3,3,3-pentafluoroprop-1-en-2-yloxycyclohexane |
| SMILES | FC(F)=C(OC1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C9H11F5O/c10-8(11)7(9(12,13)14)15-6-4-2-1-3-5-6/h6H,1-5H2 |
| InChIKey | GRFZUCWUIZHKBC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.18 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|