C9H6ClF2NO — CID 23237848
3-(4-chlorophenyl)-3,3-difluoro-2-hydroxypropanenitrile (PubChem CID 23237848) has the molecular formula C9H6ClF2NO and a molecular weight of 217.60 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3,3-difluoro-2-hydroxypropanenitrile.
| Compound Name | 3-(4-chlorophenyl)-3,3-difluoro-2-hydroxypropanenitrile |
|---|---|
| PubChem CID | 23237848 |
| Molecular Formula | C9H6ClF2NO |
| Molecular Weight | 217.60 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | 3-(4-chlorophenyl)-3,3-difluoro-2-hydroxypropanenitrile |
| SMILES | N#CC(O)C(F)(F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H6ClF2NO/c10-7-3-1-6(2-4-7)9(11,12)8(14)5-13/h1-4,8,14H |
| InChIKey | DEFLNHDSBASVGC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.60 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|