C13H12N4O4 — CID 23238201
ethyl 2-[(E)-3-azido-3-oxoprop-1-enyl]-4-methylfuro[3,2-b]pyrrole-5-carboxylate (PubChem CID 23238201) has the molecular formula C13H12N4O4 and a molecular weight of 288.26 g/mol. Its IUPAC name is ethyl 2-[(E)-3-azido-3-oxoprop-1-enyl]-4-methylfuro[3,2-b]pyrrole-5-carboxylate.
| Compound Name | ethyl 2-[(E)-3-azido-3-oxoprop-1-enyl]-4-methylfuro[3,2-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 23238201 |
| Molecular Formula | C13H12N4O4 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | ethyl 2-[(E)-3-azido-3-oxoprop-1-enyl]-4-methylfuro[3,2-b]pyrrole-5-carboxylate |
| SMILES | CCOC(=O)c1cc2oc(/C=C/C(=O)N=[N+]=[N-])cc2n1C |
| InChI | InChI=1S/C13H12N4O4/c1-3-20-13(19)10-7-11-9(17(10)2)6-8(21-11)4-5-12(18)15-16-14/h4-7H,3H2,1-2H3/b5-4+ |
| InChIKey | IDHUBQMLMDSLOS-SNAWJCMRSA-N |
| XLogP | 2.80 |
| TPSA | 110.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|