C21H31NO — CID 23239154
N-(2-methoxyphenyl)-3,3,5,5-tetramethyl-1,2,4,4a,6,7-hexahydronaphthalen-2-amine (PubChem CID 23239154) has the molecular formula C21H31NO and a molecular weight of 313.48 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-3,3,5,5-tetramethyl-1,2,4,4a,6,7-hexahydronaphthalen-2-amine.
| Compound Name | N-(2-methoxyphenyl)-3,3,5,5-tetramethyl-1,2,4,4a,6,7-hexahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 23239154 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.48 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | N-(2-methoxyphenyl)-3,3,5,5-tetramethyl-1,2,4,4a,6,7-hexahydronaphthalen-2-amine |
| SMILES | COc1ccccc1NC1CC2=CCCC(C)(C)C2CC1(C)C |
| InChI | InChI=1S/C21H31NO/c1-20(2)12-8-9-15-13-19(21(3,4)14-16(15)20)22-17-10-6-7-11-18(17)23-5/h6-7,9-11,16,19,22H,8,12-14H2,1-5H3 |
| InChIKey | MMRMZJLLFJDEQW-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.48 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|