C21H29N3OS — CID 2431591
1-(2-methoxyphenyl)-3-[[(3E)-4-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]buta-1,3-dien-2-yl]amino]thiourea (PubChem CID 2431591) has the molecular formula C21H29N3OS and a molecular weight of 371.55 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-[[(3E)-4-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]buta-1,3-dien-2-yl]amino]thiourea.
| Compound Name | 1-(2-methoxyphenyl)-3-[[(3E)-4-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]buta-1,3-dien-2-yl]amino]thiourea |
|---|---|
| PubChem CID | 2431591 |
| Molecular Formula | C21H29N3OS |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-[[(3E)-4-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]buta-1,3-dien-2-yl]amino]thiourea |
| SMILES | C=C(/C=C/[C@H]1C(C)=CCCC1(C)C)NNC(=S)Nc1ccccc1OC |
| InChI | InChI=1S/C21H29N3OS/c1-15-9-8-14-21(3,4)17(15)13-12-16(2)23-24-20(26)22-18-10-6-7-11-19(18)25-5/h6-7,9-13,17,23H,2,8,14H2,1,3-5H3,(H2,22,24,26)/b13-12+/t17-/m0/s1 |
| InChIKey | SSJALLVGOACWKX-UJGDBWEASA-N |
| XLogP | 4.94 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|