C16H20N4OS2 — CID 90917113
1-(2-bicyclo[2.2.1]hept-1(6)-enyl)-3-[(2-methoxyphenyl)carbamothioylamino]thiourea (PubChem CID 90917113) has the molecular formula C16H20N4OS2 and a molecular weight of 348.50 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]hept-1(6)-enyl)-3-[(2-methoxyphenyl)carbamothioylamino]thiourea.
| Compound Name | 1-(2-bicyclo[2.2.1]hept-1(6)-enyl)-3-[(2-methoxyphenyl)carbamothioylamino]thiourea |
|---|---|
| PubChem CID | 90917113 |
| Molecular Formula | C16H20N4OS2 |
| Molecular Weight | 348.50 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]hept-1(6)-enyl)-3-[(2-methoxyphenyl)carbamothioylamino]thiourea |
| SMILES | COc1ccccc1NC(=S)NNC(=S)NC1CC2CC=C1C2 |
| InChI | InChI=1S/C16H20N4OS2/c1-21-14-5-3-2-4-12(14)17-15(22)19-20-16(23)18-13-9-10-6-7-11(13)8-10/h2-5,7,10,13H,6,8-9H2,1H3,(H2,17,19,22)(H2,18,20,23) |
| InChIKey | JMMCOBUJTITEHV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 57.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|