C18H23N3O2S — CID 3432581
6-hydroxy-N-(2-methoxyphenyl)-3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]non-8-ene-7-carbothioamide (PubChem CID 3432581) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is 6-hydroxy-N-(2-methoxyphenyl)-3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]non-8-ene-7-carbothioamide.
| Compound Name | 6-hydroxy-N-(2-methoxyphenyl)-3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]non-8-ene-7-carbothioamide |
|---|---|
| PubChem CID | 3432581 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 6-hydroxy-N-(2-methoxyphenyl)-3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]non-8-ene-7-carbothioamide |
| SMILES | COc1ccccc1NC(=S)N1N=C(C)C2C3C(CC21O)C3(C)C |
| InChI | InChI=1S/C18H23N3O2S/c1-10-14-15-11(17(15,2)3)9-18(14,22)21(20-10)16(24)19-12-7-5-6-8-13(12)23-4/h5-8,11,14-15,22H,9H2,1-4H3,(H,19,24) |
| InChIKey | DUWTZLBLKJDPSN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|