C24H25N5OS — CID 59807232
4-(3-cyano-5,7-dimethylquinolin-2-yl)-N-(2-methoxyphenyl)piperazine-1-carbothioamide (PubChem CID 59807232) has the molecular formula C24H25N5OS and a molecular weight of 431.57 g/mol. Its IUPAC name is 4-(3-cyano-5,7-dimethylquinolin-2-yl)-N-(2-methoxyphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-(3-cyano-5,7-dimethylquinolin-2-yl)-N-(2-methoxyphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 59807232 |
| Molecular Formula | C24H25N5OS |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 4-(3-cyano-5,7-dimethylquinolin-2-yl)-N-(2-methoxyphenyl)piperazine-1-carbothioamide |
| SMILES | COc1ccccc1NC(=S)N1CCN(c2nc3cc(C)cc(C)c3cc2C#N)CC1 |
| InChI | InChI=1S/C24H25N5OS/c1-16-12-17(2)19-14-18(15-25)23(26-21(19)13-16)28-8-10-29(11-9-28)24(31)27-20-6-4-5-7-22(20)30-3/h4-7,12-14H,8-11H2,1-3H3,(H,27,31) |
| InChIKey | KXEYVGSNMJNAND-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 64.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|