C25H27N5OS — CID 1451623
4-(3-cyano-5,7-dimethylquinolin-2-yl)-N-(4-methoxyphenyl)-1,4-diazepane-1-carbothioamide (PubChem CID 1451623) has the molecular formula C25H27N5OS and a molecular weight of 445.59 g/mol. Its IUPAC name is 4-(3-cyano-5,7-dimethylquinolin-2-yl)-N-(4-methoxyphenyl)-1,4-diazepane-1-carbothioamide.
| Compound Name | 4-(3-cyano-5,7-dimethylquinolin-2-yl)-N-(4-methoxyphenyl)-1,4-diazepane-1-carbothioamide |
|---|---|
| PubChem CID | 1451623 |
| Molecular Formula | C25H27N5OS |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 4-(3-cyano-5,7-dimethylquinolin-2-yl)-N-(4-methoxyphenyl)-1,4-diazepane-1-carbothioamide |
| SMILES | COc1ccc(NC(=S)N2CCCN(c3nc4cc(C)cc(C)c4cc3C#N)CC2)cc1 |
| InChI | InChI=1S/C25H27N5OS/c1-17-13-18(2)22-15-19(16-26)24(28-23(22)14-17)29-9-4-10-30(12-11-29)25(32)27-20-5-7-21(31-3)8-6-20/h5-8,13-15H,4,9-12H2,1-3H3,(H,27,32) |
| InChIKey | OIZIYRLIALCZAZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 64.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|