C20H27N5OS — CID 5302543
N-(4-methoxyphenyl)-4-(2-methyl-6-propylpyrimidin-4-yl)piperazine-1-carbothioamide (PubChem CID 5302543) has the molecular formula C20H27N5OS and a molecular weight of 385.54 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-4-(2-methyl-6-propylpyrimidin-4-yl)piperazine-1-carbothioamide.
| Compound Name | N-(4-methoxyphenyl)-4-(2-methyl-6-propylpyrimidin-4-yl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 5302543 |
| Molecular Formula | C20H27N5OS |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-(4-methoxyphenyl)-4-(2-methyl-6-propylpyrimidin-4-yl)piperazine-1-carbothioamide |
| SMILES | CCCc1cc(N2CCN(C(=S)Nc3ccc(OC)cc3)CC2)nc(C)n1 |
| InChI | InChI=1S/C20H27N5OS/c1-4-5-17-14-19(22-15(2)21-17)24-10-12-25(13-11-24)20(27)23-16-6-8-18(26-3)9-7-16/h6-9,14H,4-5,10-13H2,1-3H3,(H,23,27) |
| InChIKey | LEKLWJVHMBNTRZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|