About [(1S)-1,3-dicarboxy-3-methylsulfanylpropyl]azanium
[(1S)-1,3-dicarboxy-3-methylsulfanylpropyl]azanium (PubChem CID 23239200) has the molecular formula C6H12NO4S+
and a molecular weight of 194.23 g/mol. Its IUPAC name is [(1S)-1,3-dicarboxy-3-methylsulfanylpropyl]azanium.
Molecular Properties
| Compound Name | [(1S)-1,3-dicarboxy-3-methylsulfanylpropyl]azanium |
| PubChem CID | 23239200 |
| Molecular Formula | C6H12NO4S+ |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | [(1S)-1,3-dicarboxy-3-methylsulfanylpropyl]azanium |
| SMILES | CSC(C[C@H]([NH3+])C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H11NO4S/c1-12-4(6(10)11)2-3(7)5(8)9/h3-4H,2,7H2,1H3,(H,8,9)(H,10,11)/p+1/t3-,4?/m0/s1 |
| InChIKey | LBNSWLUTRJJRJP-WUCPZUCCSA-O |
| XLogP | -1.11 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1S)-1,3-dicarboxy-3-methylsulfanylpropyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1,3-dicarboxy-3-methylsulfanylpropyl]azanium?
The IUPAC name of [(1S)-1,3-dicarboxy-3-methylsulfanylpropyl]azanium (CID 23239200) is [(1S)-1,3-dicarboxy-3-methylsulfanylpropyl]azanium.
What is the SMILES notation for [(1S)-1,3-dicarboxy-3-methylsulfanylpropyl]azanium?
The canonical SMILES for [(1S)-1,3-dicarboxy-3-methylsulfanylpropyl]azanium is CSC(C[C@H]([NH3+])C(=O)O)C(=O)O.
What is the InChIKey of [(1S)-1,3-dicarboxy-3-methylsulfanylpropyl]azanium?
The InChIKey is LBNSWLUTRJJRJP-WUCPZUCCSA-O. The full InChI is InChI=1S/C6H11NO4S/c1-12-4(6(10)11)2-3(7)5(8)9/h3-4H,2,7H2,1H3,(H,8,9)(H,10,11)/p+1/t3-,4?/m0/s1.
What are the key properties of [(1S)-1,3-dicarboxy-3-methylsulfanylpropyl]azanium?
[(1S)-1,3-dicarboxy-3-methylsulfanylpropyl]azanium has a molecular weight of 194.23 g/mol, XLogP of -1.11, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1,3-dicarboxy-3-methylsulfanylpropyl]azanium is sourced from PubChem (CID 23239200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).