C10H12O2S — CID 6426746
(2S)-2-methylsulfanyl-3-phenylpropanoic acid (PubChem CID 6426746) has the molecular formula C10H12O2S and a molecular weight of 196.27 g/mol. Its IUPAC name is (2S)-2-methylsulfanyl-3-phenylpropanoic acid.
| Compound Name | (2S)-2-methylsulfanyl-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 6426746 |
| Molecular Formula | C10H12O2S |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | (2S)-2-methylsulfanyl-3-phenylpropanoic acid |
| SMILES | CS[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C10H12O2S/c1-13-9(10(11)12)7-8-5-3-2-4-6-8/h2-6,9H,7H2,1H3,(H,11,12)/t9-/m0/s1 |
| InChIKey | CYAZQTVQDWFWTK-VIFPVBQESA-N |
| XLogP | 2.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |