C18H23NO5S — CID 23240244
1-[(1R,2R,6R,7S,9R,12R)-7-methoxy-4-methyl-12-phenyl-8,11,13-trioxa-3-thia-5-azatricyclo[7.4.0.02,6]tridecan-5-yl]ethanone (PubChem CID 23240244) has the molecular formula C18H23NO5S and a molecular weight of 365.45 g/mol. Its IUPAC name is 1-[(1R,2R,6R,7S,9R,12R)-7-methoxy-4-methyl-12-phenyl-8,11,13-trioxa-3-thia-5-azatricyclo[7.4.0.02,6]tridecan-5-yl]ethanone.
| Compound Name | 1-[(1R,2R,6R,7S,9R,12R)-7-methoxy-4-methyl-12-phenyl-8,11,13-trioxa-3-thia-5-azatricyclo[7.4.0.02,6]tridecan-5-yl]ethanone |
|---|---|
| PubChem CID | 23240244 |
| Molecular Formula | C18H23NO5S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 1-[(1R,2R,6R,7S,9R,12R)-7-methoxy-4-methyl-12-phenyl-8,11,13-trioxa-3-thia-5-azatricyclo[7.4.0.02,6]tridecan-5-yl]ethanone |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@@H]2SC(C)N(C(C)=O)[C@H]12 |
| InChI | InChI=1S/C18H23NO5S/c1-10(20)19-11(2)25-16-14(19)18(21-3)23-13-9-22-17(24-15(13)16)12-7-5-4-6-8-12/h4-8,11,13-18H,9H2,1-3H3/t11?,13-,14+,15-,16-,17-,18+/m1/s1 |
| InChIKey | FBSCNKNPGSWCMF-RYRFESMMSA-N |
| XLogP | 2.15 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |