C10H17BrO3 — CID 23241170
(3S,5S)-5-[(1R)-1-bromo-3-methylbutyl]-3-methoxyoxolan-2-one (PubChem CID 23241170) has the molecular formula C10H17BrO3 and a molecular weight of 265.15 g/mol. Its IUPAC name is (3S,5S)-5-[(1R)-1-bromo-3-methylbutyl]-3-methoxyoxolan-2-one.
| Compound Name | (3S,5S)-5-[(1R)-1-bromo-3-methylbutyl]-3-methoxyoxolan-2-one |
|---|---|
| PubChem CID | 23241170 |
| Molecular Formula | C10H17BrO3 |
| Molecular Weight | 265.15 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | (3S,5S)-5-[(1R)-1-bromo-3-methylbutyl]-3-methoxyoxolan-2-one |
| SMILES | CO[C@H]1C[C@@H]([C@H](Br)CC(C)C)OC1=O |
| InChI | InChI=1S/C10H17BrO3/c1-6(2)4-7(11)8-5-9(13-3)10(12)14-8/h6-9H,4-5H2,1-3H3/t7-,8+,9+/m1/s1 |
| InChIKey | PSUONNDNTSSZAK-VGMNWLOBSA-N |
| XLogP | 2.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.15 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|