C15H26O12 — CID 101205503
(3S,5S)-3-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]-5-[(1S,2R,3S,4R)-1,2,3,4-tetrahydroxypentyl]oxolan-2-one (PubChem CID 101205503) has the molecular formula C15H26O12 and a molecular weight of 398.36 g/mol. Its IUPAC name is (3S,5S)-3-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]-5-[(1S,2R,3S,4R)-1,2,3,4-tetrahydroxypentyl]oxolan-2-one.
| Compound Name | (3S,5S)-3-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]-5-[(1S,2R,3S,4R)-1,2,3,4-tetrahydroxypentyl]oxolan-2-one |
|---|---|
| PubChem CID | 101205503 |
| Molecular Formula | C15H26O12 |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | (3S,5S)-3-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]-5-[(1S,2R,3S,4R)-1,2,3,4-tetrahydroxypentyl]oxolan-2-one |
| SMILES | C[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@@H]1C[C@H](OC[C@H]2OC(O)[C@H](O)[C@@H](O)[C@@H]2O)C(=O)O1 |
| InChI | InChI=1S/C15H26O12/c1-4(16)8(17)11(20)9(18)5-2-6(14(23)26-5)25-3-7-10(19)12(21)13(22)15(24)27-7/h4-13,15-22,24H,2-3H2,1H3/t4-,5+,6+,7-,8+,9-,10-,11-,12+,13-,15?/m1/s1 |
| InChIKey | JUSXIPYVWSENMK-VDHRGQJASA-N |
| XLogP | -5.05 |
| TPSA | 206.60 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | -5.05 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |