C15H28O13 — CID 163193995
(2S,4S,5S,6R,7S,8R)-4,5,6,7,8-pentahydroxy-2-[[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]nonanoic acid (PubChem CID 163193995) has the molecular formula C15H28O13 and a molecular weight of 416.38 g/mol. Its IUPAC name is (2S,4S,5S,6R,7S,8R)-4,5,6,7,8-pentahydroxy-2-[[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]nonanoic acid.
| Compound Name | (2S,4S,5S,6R,7S,8R)-4,5,6,7,8-pentahydroxy-2-[[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]nonanoic acid |
|---|---|
| PubChem CID | 163193995 |
| Molecular Formula | C15H28O13 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | (2S,4S,5S,6R,7S,8R)-4,5,6,7,8-pentahydroxy-2-[[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]nonanoic acid |
| SMILES | C[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@@H](O)C[C@H](OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O)C(=O)O |
| InChI | InChI=1S/C15H28O13/c1-4(16)8(18)11(21)9(19)5(17)2-6(14(24)25)27-3-7-10(20)12(22)13(23)15(26)28-7/h4-13,15-23,26H,2-3H2,1H3,(H,24,25)/t4-,5+,6+,7-,8+,9+,10-,11-,12+,13-,15-/m1/s1 |
| InChIKey | KCRYZEAQGJXOJA-GELVDJTCSA-N |
| XLogP | -5.53 |
| TPSA | 237.83 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | -5.53 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |