C11H22O6 — CID 166946963
6-(pentan-2-yloxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 166946963) has the molecular formula C11H22O6 and a molecular weight of 250.29 g/mol. Its IUPAC name is 6-(pentan-2-yloxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | 6-(pentan-2-yloxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 166946963 |
| Molecular Formula | C11H22O6 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 6-(pentan-2-yloxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | CCCC(C)OCC1OC(O)C(O)C(O)C1O |
| InChI | InChI=1S/C11H22O6/c1-3-4-6(2)16-5-7-8(12)9(13)10(14)11(15)17-7/h6-15H,3-5H2,1-2H3 |
| InChIKey | OLMSBLGXEXCWHP-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |