C8H13Cl3O7 — CID 86278245
(2S,3R,4S,5S,6R)-6-[(2,2,2-trichloro-1-hydroxyethoxy)methyl]oxane-2,3,4,5-tetrol (PubChem CID 86278245) has the molecular formula C8H13Cl3O7 and a molecular weight of 327.54 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-6-[(2,2,2-trichloro-1-hydroxyethoxy)methyl]oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4S,5S,6R)-6-[(2,2,2-trichloro-1-hydroxyethoxy)methyl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 86278245 |
| Molecular Formula | C8H13Cl3O7 |
| Molecular Weight | 327.54 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | (2S,3R,4S,5S,6R)-6-[(2,2,2-trichloro-1-hydroxyethoxy)methyl]oxane-2,3,4,5-tetrol |
| SMILES | OC(OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H13Cl3O7/c9-8(10,11)7(16)17-1-2-3(12)4(13)5(14)6(15)18-2/h2-7,12-16H,1H2/t2-,3-,4+,5-,6+,7?/m1/s1 |
| InChIKey | MNJXCNJRTAOSBH-MYXNHXMWSA-N |
| XLogP | -1.51 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.54 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|