C18H36O18 — CID 68514720
(2R,3S,4R,5R)-1-[[(2R,3S,4S,5R,6S)-5-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]-3,4,6-trihydroxyoxan-2-yl]methoxy]hexane-1,2,3,4,5,6-hexol (PubChem CID 68514720) has the molecular formula C18H36O18 and a molecular weight of 540.47 g/mol. Its IUPAC name is (2R,3S,4R,5R)-1-[[(2R,3S,4S,5R,6S)-5-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]-3,4,6-trihydroxyoxan-2-yl]methoxy]hexane-1,2,3,4,5,6-hexol.
| Compound Name | (2R,3S,4R,5R)-1-[[(2R,3S,4S,5R,6S)-5-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]-3,4,6-trihydroxyoxan-2-yl]methoxy]hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 68514720 |
| Molecular Formula | C18H36O18 |
| Molecular Weight | 540.47 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | (2R,3S,4R,5R)-1-[[(2R,3S,4S,5R,6S)-5-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]-3,4,6-trihydroxyoxan-2-yl]methoxy]hexane-1,2,3,4,5,6-hexol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)OC[C@H]1O[C@H](O)[C@H](OC(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H36O18/c19-1-4(21)7(23)10(26)13(29)16(31)34-3-6-9(25)12(28)15(18(33)35-6)36-17(32)14(30)11(27)8(24)5(22)2-20/h4-33H,1-3H2/t4-,5-,6-,7-,8-,9-,10+,11+,12+,13-,14-,15-,16?,17?,18+/m1/s1 |
| InChIKey | XYTJEXKKJVYBCJ-AEZAMWOTSA-N |
| XLogP | -9.66 |
| TPSA | 331.14 Ų |
| H-Bond Donors | 15 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.47 |
| LogP ≤ 5 | -9.66 |
| H-Bond Donors ≤ 5 | 15 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|